About (E)-2-oxoethylideneurea
(E)-2-oxoethylideneurea (PubChem CID 15859944) has the molecular formula C3H4N2O2
and a molecular weight of 100.08 g/mol. Its IUPAC name is (E)-2-oxoethylideneurea.
Molecular Properties
| Compound Name | (E)-2-oxoethylideneurea |
| PubChem CID | 15859944 |
| Molecular Formula | C3H4N2O2 |
| Molecular Weight | 100.08 g/mol |
| Exact Mass | 100.03 |
| IUPAC Name | (E)-2-oxoethylideneurea |
| SMILES | NC(=O)/N=C/C=O |
| InChI | InChI=1S/C3H4N2O2/c4-3(7)5-1-2-6/h1-2H,(H2,4,7)/b5-1+ |
| InChIKey | UURVPJVBLPEWQE-ORCRQEGFSA-N |
| XLogP | -0.67 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.08 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-oxoethylideneurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-oxoethylideneurea?
The IUPAC name of (E)-2-oxoethylideneurea (CID 15859944) is (E)-2-oxoethylideneurea.
What is the SMILES notation for (E)-2-oxoethylideneurea?
The canonical SMILES for (E)-2-oxoethylideneurea is NC(=O)/N=C/C=O.
What is the InChIKey of (E)-2-oxoethylideneurea?
The InChIKey is UURVPJVBLPEWQE-ORCRQEGFSA-N. The full InChI is InChI=1S/C3H4N2O2/c4-3(7)5-1-2-6/h1-2H,(H2,4,7)/b5-1+.
What are the key properties of (E)-2-oxoethylideneurea?
(E)-2-oxoethylideneurea has a molecular weight of 100.08 g/mol, XLogP of -0.67, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-oxoethylideneurea is sourced from PubChem (CID 15859944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).