About formamide;urea
formamide;urea (PubChem CID 19591694) has the molecular formula C2H7N3O2
and a molecular weight of 105.10 g/mol. Its IUPAC name is formamide;urea.
Molecular Properties
| Compound Name | formamide;urea |
| PubChem CID | 19591694 |
| Molecular Formula | C2H7N3O2 |
| Molecular Weight | 105.10 g/mol |
| Exact Mass | 105.05 |
| IUPAC Name | formamide;urea |
| SMILES | NC(N)=O.NC=O |
| InChI | InChI=1S/CH4N2O.CH3NO/c2-1(3)4;2-1-3/h(H4,2,3,4);1H,(H2,2,3) |
| InChIKey | XZSDLFHCPIUHJB-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.10 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formamide;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formamide;urea?
The IUPAC name of formamide;urea (CID 19591694) is formamide;urea.
What is the SMILES notation for formamide;urea?
The canonical SMILES for formamide;urea is NC(N)=O.NC=O.
What is the InChIKey of formamide;urea?
The InChIKey is XZSDLFHCPIUHJB-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O.CH3NO/c2-1(3)4;2-1-3/h(H4,2,3,4);1H,(H2,2,3).
What are the key properties of formamide;urea?
formamide;urea has a molecular weight of 105.10 g/mol, XLogP of -1.87, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formamide;urea is sourced from PubChem (CID 19591694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).