C7H13N3O2 — CID 159487096
ethylideneurea;N-methylprop-2-enamide (PubChem CID 159487096) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is ethylideneurea;N-methylprop-2-enamide.
| Compound Name | ethylideneurea;N-methylprop-2-enamide |
|---|---|
| PubChem CID | 159487096 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | ethylideneurea;N-methylprop-2-enamide |
| SMILES | C=CC(=O)NC.CC=NC(N)=O |
| InChI | InChI=1S/C4H7NO.C3H6N2O/c1-3-4(6)5-2;1-2-5-3(4)6/h3H,1H2,2H3,(H,5,6);2H,1H3,(H2,4,6) |
| InChIKey | LXSHGMFGXLKRGY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|