About diethylalumanylium;N-methylprop-2-enamide;chloride
diethylalumanylium;N-methylprop-2-enamide;chloride (PubChem CID 175303125) has the molecular formula C8H17AlClNO
and a molecular weight of 205.66 g/mol. Its IUPAC name is diethylalumanylium;N-methylprop-2-enamide;chloride.
Molecular Properties
| Compound Name | diethylalumanylium;N-methylprop-2-enamide;chloride |
| PubChem CID | 175303125 |
| Molecular Formula | C8H17AlClNO |
| Molecular Weight | 205.66 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | diethylalumanylium;N-methylprop-2-enamide;chloride |
| SMILES | C=CC(=O)NC.CC[Al+]CC.[Cl-] |
| InChI | InChI=1S/C4H7NO.2C2H5.Al.ClH/c1-3-4(6)5-2;2*1-2;;/h3H,1H2,2H3,(H,5,6);2*1H2,2H3;;1H/q;;;+1;/p-1 |
| InChIKey | PYMDGTORRJCFNV-UHFFFAOYSA-M |
| XLogP | -1.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.66 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diethylalumanylium;N-methylprop-2-enamide;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethylalumanylium;N-methylprop-2-enamide;chloride?
The IUPAC name of diethylalumanylium;N-methylprop-2-enamide;chloride (CID 175303125) is diethylalumanylium;N-methylprop-2-enamide;chloride.
What is the SMILES notation for diethylalumanylium;N-methylprop-2-enamide;chloride?
The canonical SMILES for diethylalumanylium;N-methylprop-2-enamide;chloride is C=CC(=O)NC.CC[Al+]CC.[Cl-].
What is the InChIKey of diethylalumanylium;N-methylprop-2-enamide;chloride?
The InChIKey is PYMDGTORRJCFNV-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H7NO.2C2H5.Al.ClH/c1-3-4(6)5-2;2*1-2;;/h3H,1H2,2H3,(H,5,6);2*1H2,2H3;;1H/q;;;+1;/p-1.
What are the key properties of diethylalumanylium;N-methylprop-2-enamide;chloride?
diethylalumanylium;N-methylprop-2-enamide;chloride has a molecular weight of 205.66 g/mol, XLogP of -1.51, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diethylalumanylium;N-methylprop-2-enamide;chloride is sourced from PubChem (CID 175303125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).