C9H19N3O2 — CID 174740802
but-1-ene;N-methylprop-2-enamide;urea (PubChem CID 174740802) has the molecular formula C9H19N3O2 and a molecular weight of 201.27 g/mol. Its IUPAC name is but-1-ene;N-methylprop-2-enamide;urea.
| Compound Name | but-1-ene;N-methylprop-2-enamide;urea |
|---|---|
| PubChem CID | 174740802 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | but-1-ene;N-methylprop-2-enamide;urea |
| SMILES | C=CC(=O)NC.C=CCC.NC(N)=O |
| InChI | InChI=1S/C4H7NO.C4H8.CH4N2O/c1-3-4(6)5-2;1-3-4-2;2-1(3)4/h3H,1H2,2H3,(H,5,6);3H,1,4H2,2H3;(H4,2,3,4) |
| InChIKey | MXPLUUPXQQNTRU-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|