C7H16N4O3 — CID 174639401
acetic acid;guanidine;N-methylprop-2-enamide (PubChem CID 174639401) has the molecular formula C7H16N4O3 and a molecular weight of 204.23 g/mol. Its IUPAC name is acetic acid;guanidine;N-methylprop-2-enamide.
| Compound Name | acetic acid;guanidine;N-methylprop-2-enamide |
|---|---|
| PubChem CID | 174639401 |
| Molecular Formula | C7H16N4O3 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | acetic acid;guanidine;N-methylprop-2-enamide |
| SMILES | C=CC(=O)NC.CC(=O)O.[H]N=C(N)N |
| InChI | InChI=1S/C4H7NO.C2H4O2.CH5N3/c1-3-4(6)5-2;1-2(3)4;2-1(3)4/h3H,1H2,2H3,(H,5,6);1H3,(H,3,4);(H5,2,3,4) |
| InChIKey | FOAFBWNYDNYFHQ-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 142.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|