About ethylideneurea;ethyl 2-methylprop-2-enoate
ethylideneurea;ethyl 2-methylprop-2-enoate (PubChem CID 175474375) has the molecular formula C9H16N2O3
and a molecular weight of 200.24 g/mol. Its IUPAC name is ethylideneurea;ethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | ethylideneurea;ethyl 2-methylprop-2-enoate |
| PubChem CID | 175474375 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | ethylideneurea;ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC.CC=NC(N)=O |
| InChI | InChI=1S/C6H10O2.C3H6N2O/c1-4-8-6(7)5(2)3;1-2-5-3(4)6/h2,4H2,1,3H3;2H,1H3,(H2,4,6) |
| InChIKey | RXOVVJJIURROJV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethylideneurea;ethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylideneurea;ethyl 2-methylprop-2-enoate?
The IUPAC name of ethylideneurea;ethyl 2-methylprop-2-enoate (CID 175474375) is ethylideneurea;ethyl 2-methylprop-2-enoate.
What is the SMILES notation for ethylideneurea;ethyl 2-methylprop-2-enoate?
The canonical SMILES for ethylideneurea;ethyl 2-methylprop-2-enoate is C=C(C)C(=O)OCC.CC=NC(N)=O.
What is the InChIKey of ethylideneurea;ethyl 2-methylprop-2-enoate?
The InChIKey is RXOVVJJIURROJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C3H6N2O/c1-4-8-6(7)5(2)3;1-2-5-3(4)6/h2,4H2,1,3H3;2H,1H3,(H2,4,6).
What are the key properties of ethylideneurea;ethyl 2-methylprop-2-enoate?
ethylideneurea;ethyl 2-methylprop-2-enoate has a molecular weight of 200.24 g/mol, XLogP of 1.28, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethylideneurea;ethyl 2-methylprop-2-enoate is sourced from PubChem (CID 175474375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).