About N-ethylideneacetamide
N-ethylideneacetamide (PubChem CID 21338179) has the molecular formula C4H7NO
and a molecular weight of 85.11 g/mol. Its IUPAC name is N-ethylideneacetamide.
Molecular Properties
| Compound Name | N-ethylideneacetamide |
| PubChem CID | 21338179 |
| Molecular Formula | C4H7NO |
| Molecular Weight | 85.11 g/mol |
| Exact Mass | 85.05 |
| IUPAC Name | N-ethylideneacetamide |
| SMILES | C/C=N/C(C)=O |
| InChI | InChI=1S/C4H7NO/c1-3-5-4(2)6/h3H,1-2H3/b5-3+ |
| InChIKey | GIBNSWPQESNKRG-HWKANZROSA-N |
| XLogP | 0.62 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 85.11 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethylideneacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylideneacetamide?
The IUPAC name of N-ethylideneacetamide (CID 21338179) is N-ethylideneacetamide.
What is the SMILES notation for N-ethylideneacetamide?
The canonical SMILES for N-ethylideneacetamide is C/C=N/C(C)=O.
What is the InChIKey of N-ethylideneacetamide?
The InChIKey is GIBNSWPQESNKRG-HWKANZROSA-N. The full InChI is InChI=1S/C4H7NO/c1-3-5-4(2)6/h3H,1-2H3/b5-3+.
What are the key properties of N-ethylideneacetamide?
N-ethylideneacetamide has a molecular weight of 85.11 g/mol, XLogP of 0.62, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylideneacetamide is sourced from PubChem (CID 21338179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).