C5H8N2O3 — CID 141148966
1-(2,2-dihydroxyethylidene)-3-ethylideneurea (PubChem CID 141148966) has the molecular formula C5H8N2O3 and a molecular weight of 144.13 g/mol. Its IUPAC name is 1-(2,2-dihydroxyethylidene)-3-ethylideneurea.
| Compound Name | 1-(2,2-dihydroxyethylidene)-3-ethylideneurea |
|---|---|
| PubChem CID | 141148966 |
| Molecular Formula | C5H8N2O3 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | 1-(2,2-dihydroxyethylidene)-3-ethylideneurea |
| SMILES | CC=NC(=O)N=CC(O)O |
| InChI | InChI=1S/C5H8N2O3/c1-2-6-5(10)7-3-4(8)9/h2-4,8-9H,1H3 |
| InChIKey | GEVNHIMHRAHWDH-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 82.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|