2-acetyliminoacetic acid

C4H5NO3 — CID 131637969

IUPAC2-acetyliminoacetic acid
SMILESCC(=O)/[15N]=[13CH]/[13C](=O)O
InChIInChI=1S/C4H5NO3/c1-3(6)5-2-4(7)8/h2H,1H3,(H,7,8)/b5-2+/i2+1,4+1,5+1
InChIKeyUDBARZGUZJPRIX-BVTWOJRUSA-N
MW118.07 g/mol
LogP-0.31
Rot. Bonds1

About 2-acetyliminoacetic acid

2-acetyliminoacetic acid (PubChem CID 131637969) has the molecular formula C4H5NO3 and a molecular weight of 118.07 g/mol. Its IUPAC name is 2-acetyliminoacetic acid.

Molecular Properties

Compound Name2-acetyliminoacetic acid
PubChem CID131637969
Molecular FormulaC4H5NO3
Molecular Weight118.07 g/mol
Exact Mass118.03
IUPAC Name2-acetyliminoacetic acid
SMILESCC(=O)/[15N]=[13CH]/[13C](=O)O
InChIInChI=1S/C4H5NO3/c1-3(6)5-2-4(7)8/h2H,1H3,(H,7,8)/b5-2+/i2+1,4+1,5+1
InChIKeyUDBARZGUZJPRIX-BVTWOJRUSA-N
XLogP-0.31
TPSA66.73 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500118.07
LogP ≤ 5-0.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze 2-acetyliminoacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetyliminoacetic acid?
The IUPAC name of 2-acetyliminoacetic acid (CID 131637969) is 2-acetyliminoacetic acid.
What is the SMILES notation for 2-acetyliminoacetic acid?
The canonical SMILES for 2-acetyliminoacetic acid is CC(=O)/[15N]=[13CH]/[13C](=O)O.
What is the InChIKey of 2-acetyliminoacetic acid?
The InChIKey is UDBARZGUZJPRIX-BVTWOJRUSA-N. The full InChI is InChI=1S/C4H5NO3/c1-3(6)5-2-4(7)8/h2H,1H3,(H,7,8)/b5-2+/i2+1,4+1,5+1.
What are the key properties of 2-acetyliminoacetic acid?
2-acetyliminoacetic acid has a molecular weight of 118.07 g/mol, XLogP of -0.31, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyliminoacetic acid is sourced from PubChem (CID 131637969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).