About 2-acetyliminoacetic acid
2-acetyliminoacetic acid (PubChem CID 131637969) has the molecular formula C4H5NO3
and a molecular weight of 118.07 g/mol. Its IUPAC name is 2-acetyliminoacetic acid.
Molecular Properties
| Compound Name | 2-acetyliminoacetic acid |
| PubChem CID | 131637969 |
| Molecular Formula | C4H5NO3 |
| Molecular Weight | 118.07 g/mol |
| Exact Mass | 118.03 |
| IUPAC Name | 2-acetyliminoacetic acid |
| SMILES | CC(=O)/[15N]=[13CH]/[13C](=O)O |
| InChI | InChI=1S/C4H5NO3/c1-3(6)5-2-4(7)8/h2H,1H3,(H,7,8)/b5-2+/i2+1,4+1,5+1 |
| InChIKey | UDBARZGUZJPRIX-BVTWOJRUSA-N |
| XLogP | -0.31 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.07 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyliminoacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyliminoacetic acid?
The IUPAC name of 2-acetyliminoacetic acid (CID 131637969) is 2-acetyliminoacetic acid.
What is the SMILES notation for 2-acetyliminoacetic acid?
The canonical SMILES for 2-acetyliminoacetic acid is CC(=O)/[15N]=[13CH]/[13C](=O)O.
What is the InChIKey of 2-acetyliminoacetic acid?
The InChIKey is UDBARZGUZJPRIX-BVTWOJRUSA-N. The full InChI is InChI=1S/C4H5NO3/c1-3(6)5-2-4(7)8/h2H,1H3,(H,7,8)/b5-2+/i2+1,4+1,5+1.
What are the key properties of 2-acetyliminoacetic acid?
2-acetyliminoacetic acid has a molecular weight of 118.07 g/mol, XLogP of -0.31, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyliminoacetic acid is sourced from PubChem (CID 131637969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).