C11H17NO — CID 138703081
N-[(2Z)-3-methyl-2-propylpenta-2,4-dienylidene]acetamide (PubChem CID 138703081) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is N-[(2Z)-3-methyl-2-propylpenta-2,4-dienylidene]acetamide.
| Compound Name | N-[(2Z)-3-methyl-2-propylpenta-2,4-dienylidene]acetamide |
|---|---|
| PubChem CID | 138703081 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-[(2Z)-3-methyl-2-propylpenta-2,4-dienylidene]acetamide |
| SMILES | C=C/C(C)=C(\C=N\C(C)=O)CCC |
| InChI | InChI=1S/C11H17NO/c1-5-7-11(9(3)6-2)8-12-10(4)13/h6,8H,2,5,7H2,1,3-4H3/b11-9-,12-8+ |
| InChIKey | OTDRZWIQVZNRTG-NFDHXRNHSA-N |
| XLogP | 2.91 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|