C10H19N3O2 — CID 155582695
(Z)-3-amino-N-formyl-5-imino-4-methylpent-3-enamide;propane (PubChem CID 155582695) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is (Z)-3-amino-N-formyl-5-imino-4-methylpent-3-enamide;propane.
| Compound Name | (Z)-3-amino-N-formyl-5-imino-4-methylpent-3-enamide;propane |
|---|---|
| PubChem CID | 155582695 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | (Z)-3-amino-N-formyl-5-imino-4-methylpent-3-enamide;propane |
| SMILES | CCC.[H]/N=C/C(C)=C(\N)CC(=O)NC=O |
| InChI | InChI=1S/C7H11N3O2.C3H8/c1-5(3-8)6(9)2-7(12)10-4-11;1-3-2/h3-4,8H,2,9H2,1H3,(H,10,11,12);3H2,1-2H3/b6-5-,8-3+; |
| InChIKey | IJFACBFFWUEVHC-TWFGYXESSA-N |
| XLogP | 0.95 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|