C7H15N3O — CID 88797723
(Z)-3-amino-3-(dimethylamino)-N,N-dimethylprop-2-enamide (PubChem CID 88797723) has the molecular formula C7H15N3O and a molecular weight of 157.22 g/mol. Its IUPAC name is (Z)-3-amino-3-(dimethylamino)-N,N-dimethylprop-2-enamide.
| Compound Name | (Z)-3-amino-3-(dimethylamino)-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 88797723 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | (Z)-3-amino-3-(dimethylamino)-N,N-dimethylprop-2-enamide |
| SMILES | CN(C)C(=O)/C=C(/N)N(C)C |
| InChI | InChI=1S/C7H15N3O/c1-9(2)6(8)5-7(11)10(3)4/h5H,8H2,1-4H3/b6-5- |
| InChIKey | ARURPNHRBMDJJS-WAYWQWQTSA-N |
| XLogP | -0.56 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|