C10H20N2O — CID 167255132
(Z)-N,N,4-trimethyl-3-(methylamino)hex-2-enamide (PubChem CID 167255132) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is (Z)-N,N,4-trimethyl-3-(methylamino)hex-2-enamide.
| Compound Name | (Z)-N,N,4-trimethyl-3-(methylamino)hex-2-enamide |
|---|---|
| PubChem CID | 167255132 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | (Z)-N,N,4-trimethyl-3-(methylamino)hex-2-enamide |
| SMILES | CCC(C)/C(=C/C(=O)N(C)C)NC |
| InChI | InChI=1S/C10H20N2O/c1-6-8(2)9(11-3)7-10(13)12(4)5/h7-8,11H,6H2,1-5H3/b9-7- |
| InChIKey | GEAMKXOPBOFNAQ-CLFYSBASSA-N |
| XLogP | 1.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|