C11H18N2O4 — CID 160702434
ethyl 2-[[5-(dimethylamino)-3-hydroxy-5-oxopenta-1,3-dien-2-yl]amino]acetate (PubChem CID 160702434) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is ethyl 2-[[5-(dimethylamino)-3-hydroxy-5-oxopenta-1,3-dien-2-yl]amino]acetate.
| Compound Name | ethyl 2-[[5-(dimethylamino)-3-hydroxy-5-oxopenta-1,3-dien-2-yl]amino]acetate |
|---|---|
| PubChem CID | 160702434 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | ethyl 2-[[5-(dimethylamino)-3-hydroxy-5-oxopenta-1,3-dien-2-yl]amino]acetate |
| SMILES | C=C(NCC(=O)OCC)C(O)=CC(=O)N(C)C |
| InChI | InChI=1S/C11H18N2O4/c1-5-17-11(16)7-12-8(2)9(14)6-10(15)13(3)4/h6,12,14H,2,5,7H2,1,3-4H3 |
| InChIKey | STIRZUYWAZYGCI-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|