C12H21N3O3 — CID 118488243
(2Z)-4-[[2-(dimethylamino)-2-oxoethyl]-methylamino]-3-hydroxy-N,N-dimethylpenta-2,4-dienamide (PubChem CID 118488243) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is (2Z)-4-[[2-(dimethylamino)-2-oxoethyl]-methylamino]-3-hydroxy-N,N-dimethylpenta-2,4-dienamide.
| Compound Name | (2Z)-4-[[2-(dimethylamino)-2-oxoethyl]-methylamino]-3-hydroxy-N,N-dimethylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 118488243 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (2Z)-4-[[2-(dimethylamino)-2-oxoethyl]-methylamino]-3-hydroxy-N,N-dimethylpenta-2,4-dienamide |
| SMILES | C=C(/C(O)=C/C(=O)N(C)C)N(C)CC(=O)N(C)C |
| InChI | InChI=1S/C12H21N3O3/c1-9(10(16)7-11(17)13(2)3)15(6)8-12(18)14(4)5/h7,16H,1,8H2,2-6H3/b10-7- |
| InChIKey | BYGISMIQKUAKCO-YFHOEESVSA-N |
| XLogP | 0.05 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|