C31H56FeN6O12 — CID 148721705
N-(2-ethoxyethyl)-2-hydroxy-N,N',N'-trimethylbut-2-enediamide;bis(2-hydroxy-N-(2-methoxyethyl)-N,N',N'-trimethylbut-2-enediamide);iron (PubChem CID 148721705) has the molecular formula C31H56FeN6O12 and a molecular weight of 760.66 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-2-hydroxy-N,N',N'-trimethylbut-2-enediamide;bis(2-hydroxy-N-(2-methoxyethyl)-N,N',N'-trimethylbut-2-enediamide);iron.
| Compound Name | N-(2-ethoxyethyl)-2-hydroxy-N,N',N'-trimethylbut-2-enediamide;bis(2-hydroxy-N-(2-methoxyethyl)-N,N',N'-trimethylbut-2-enediamide);iron |
|---|---|
| PubChem CID | 148721705 |
| Molecular Formula | C31H56FeN6O12 |
| Molecular Weight | 760.66 g/mol |
| Exact Mass | 760.33 |
| IUPAC Name | N-(2-ethoxyethyl)-2-hydroxy-N,N',N'-trimethylbut-2-enediamide;bis(2-hydroxy-N-(2-methoxyethyl)-N,N',N'-trimethylbut-2-enediamide);iron |
| SMILES | CCOCCN(C)C(=O)C(O)=CC(=O)N(C)C.COCCN(C)C(=O)C(O)=CC(=O)N(C)C.COCCN(C)C(=O)C(O)=CC(=O)N(C)C.[Fe] |
| InChI | InChI=1S/C11H20N2O4.2C10H18N2O4.Fe/c1-5-17-7-6-13(4)11(16)9(14)8-10(15)12(2)3;2*1-11(2)9(14)7-8(13)10(15)12(3)5-6-16-4;/h8,14H,5-7H2,1-4H3;2*7,13H,5-6H2,1-4H3; |
| InChIKey | UJZDLHOBVPFFBS-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 210.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.66 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|