C10H18N2O4 — CID 148721706
2-hydroxy-N-(2-methoxyethyl)-N,N',N'-trimethylbut-2-enediamide (PubChem CID 148721706) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is 2-hydroxy-N-(2-methoxyethyl)-N,N',N'-trimethylbut-2-enediamide.
| Compound Name | 2-hydroxy-N-(2-methoxyethyl)-N,N',N'-trimethylbut-2-enediamide |
|---|---|
| PubChem CID | 148721706 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-hydroxy-N-(2-methoxyethyl)-N,N',N'-trimethylbut-2-enediamide |
| SMILES | COCCN(C)C(=O)C(O)=CC(=O)N(C)C |
| InChI | InChI=1S/C10H18N2O4/c1-11(2)9(14)7-8(13)10(15)12(3)5-6-16-4/h7,13H,5-6H2,1-4H3 |
| InChIKey | PQCBTNPTJNLOES-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|