C10H22N2O2 — CID 115887200
1-(2-ethoxyethyl)-3,3-diethyl-1-methylurea (PubChem CID 115887200) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-3,3-diethyl-1-methylurea.
| Compound Name | 1-(2-ethoxyethyl)-3,3-diethyl-1-methylurea |
|---|---|
| PubChem CID | 115887200 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 1-(2-ethoxyethyl)-3,3-diethyl-1-methylurea |
| SMILES | CCOCCN(C)C(=O)N(CC)CC |
| InChI | InChI=1S/C10H22N2O2/c1-5-12(6-2)10(13)11(4)8-9-14-7-3/h5-9H2,1-4H3 |
| InChIKey | TWCDTLZCQCROBJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|