C17H36N2O5 — CID 54341985
1,1,3,3-tetrakis(2-ethoxyethyl)urea (PubChem CID 54341985) has the molecular formula C17H36N2O5 and a molecular weight of 348.48 g/mol. Its IUPAC name is 1,1,3,3-tetrakis(2-ethoxyethyl)urea.
| Compound Name | 1,1,3,3-tetrakis(2-ethoxyethyl)urea |
|---|---|
| PubChem CID | 54341985 |
| Molecular Formula | C17H36N2O5 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | 1,1,3,3-tetrakis(2-ethoxyethyl)urea |
| SMILES | CCOCCN(CCOCC)C(=O)N(CCOCC)CCOCC |
| InChI | InChI=1S/C17H36N2O5/c1-5-21-13-9-18(10-14-22-6-2)17(20)19(11-15-23-7-3)12-16-24-8-4/h5-16H2,1-4H3 |
| InChIKey | TZPNSULBSACWBY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|