C12H24BrNO3 — CID 82966254
2-bromo-N,N-bis(2-ethoxyethyl)butanamide (PubChem CID 82966254) has the molecular formula C12H24BrNO3 and a molecular weight of 310.23 g/mol. Its IUPAC name is 2-bromo-N,N-bis(2-ethoxyethyl)butanamide.
| Compound Name | 2-bromo-N,N-bis(2-ethoxyethyl)butanamide |
|---|---|
| PubChem CID | 82966254 |
| Molecular Formula | C12H24BrNO3 |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 2-bromo-N,N-bis(2-ethoxyethyl)butanamide |
| SMILES | CCOCCN(CCOCC)C(=O)C(Br)CC |
| InChI | InChI=1S/C12H24BrNO3/c1-4-11(13)12(15)14(7-9-16-5-2)8-10-17-6-3/h11H,4-10H2,1-3H3 |
| InChIKey | VWAIMPBJFQBNMB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|