C15H31NO3 — CID 59687724
2-methyl-N,N-bis(2-propoxyethyl)butanamide (PubChem CID 59687724) has the molecular formula C15H31NO3 and a molecular weight of 273.42 g/mol. Its IUPAC name is 2-methyl-N,N-bis(2-propoxyethyl)butanamide.
| Compound Name | 2-methyl-N,N-bis(2-propoxyethyl)butanamide |
|---|---|
| PubChem CID | 59687724 |
| Molecular Formula | C15H31NO3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.23 |
| IUPAC Name | 2-methyl-N,N-bis(2-propoxyethyl)butanamide |
| SMILES | CCCOCCN(CCOCCC)C(=O)C(C)CC |
| InChI | InChI=1S/C15H31NO3/c1-5-10-18-12-8-16(9-13-19-11-6-2)15(17)14(4)7-3/h14H,5-13H2,1-4H3 |
| InChIKey | WPFCUGBNGWOFKP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|