C14H29N3O4 — CID 82938492
N,N-bis(2-ethoxyethyl)-2-(N'-hydroxycarbamimidoyl)-3-methylbutanamide (PubChem CID 82938492) has the molecular formula C14H29N3O4 and a molecular weight of 303.40 g/mol. Its IUPAC name is N,N-bis(2-ethoxyethyl)-2-(N'-hydroxycarbamimidoyl)-3-methylbutanamide.
| Compound Name | N,N-bis(2-ethoxyethyl)-2-(N'-hydroxycarbamimidoyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 82938492 |
| Molecular Formula | C14H29N3O4 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | N,N-bis(2-ethoxyethyl)-2-(N'-hydroxycarbamimidoyl)-3-methylbutanamide |
| SMILES | CCOCCN(CCOCC)C(=O)C(C(N)=NO)C(C)C |
| InChI | InChI=1S/C14H29N3O4/c1-5-20-9-7-17(8-10-21-6-2)14(18)12(11(3)4)13(15)16-19/h11-12,19H,5-10H2,1-4H3,(H2,15,16) |
| InChIKey | SMRLECJKEHEDKM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|