C10H20N2O5 — CID 81081493
2-[[2-ethoxyethyl(methyl)carbamoyl]amino]-3-methoxypropanoic acid (PubChem CID 81081493) has the molecular formula C10H20N2O5 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-[[2-ethoxyethyl(methyl)carbamoyl]amino]-3-methoxypropanoic acid.
| Compound Name | 2-[[2-ethoxyethyl(methyl)carbamoyl]amino]-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 81081493 |
| Molecular Formula | C10H20N2O5 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 2-[[2-ethoxyethyl(methyl)carbamoyl]amino]-3-methoxypropanoic acid |
| SMILES | CCOCCN(C)C(=O)NC(COC)C(=O)O |
| InChI | InChI=1S/C10H20N2O5/c1-4-17-6-5-12(2)10(15)11-8(7-16-3)9(13)14/h8H,4-7H2,1-3H3,(H,11,15)(H,13,14) |
| InChIKey | DNXBHKLKKGSQNY-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|