C12H24N2O5 — CID 81086150
2-[[butan-2-yl(2-methoxyethyl)carbamoyl]amino]-3-methoxypropanoic acid (PubChem CID 81086150) has the molecular formula C12H24N2O5 and a molecular weight of 276.33 g/mol. Its IUPAC name is 2-[[butan-2-yl(2-methoxyethyl)carbamoyl]amino]-3-methoxypropanoic acid.
| Compound Name | 2-[[butan-2-yl(2-methoxyethyl)carbamoyl]amino]-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 81086150 |
| Molecular Formula | C12H24N2O5 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 2-[[butan-2-yl(2-methoxyethyl)carbamoyl]amino]-3-methoxypropanoic acid |
| SMILES | CCC(C)N(CCOC)C(=O)NC(COC)C(=O)O |
| InChI | InChI=1S/C12H24N2O5/c1-5-9(2)14(6-7-18-3)12(17)13-10(8-19-4)11(15)16/h9-10H,5-8H2,1-4H3,(H,13,17)(H,15,16) |
| InChIKey | NASGHZMOKVMNQA-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |