C9H18N2O5 — CID 81086301
3-methoxy-2-[[2-methoxyethyl(methyl)carbamoyl]amino]propanoic acid (PubChem CID 81086301) has the molecular formula C9H18N2O5 and a molecular weight of 234.25 g/mol. Its IUPAC name is 3-methoxy-2-[[2-methoxyethyl(methyl)carbamoyl]amino]propanoic acid.
| Compound Name | 3-methoxy-2-[[2-methoxyethyl(methyl)carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 81086301 |
| Molecular Formula | C9H18N2O5 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 3-methoxy-2-[[2-methoxyethyl(methyl)carbamoyl]amino]propanoic acid |
| SMILES | COCCN(C)C(=O)NC(COC)C(=O)O |
| InChI | InChI=1S/C9H18N2O5/c1-11(4-5-15-2)9(14)10-7(6-16-3)8(12)13/h7H,4-6H2,1-3H3,(H,10,14)(H,12,13) |
| InChIKey | KQAXWNYKDRYQKC-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |