C13H17BrN2O4 — CID 81084331
2-[[(2-bromophenyl)methyl-methylcarbamoyl]amino]-3-methoxypropanoic acid (PubChem CID 81084331) has the molecular formula C13H17BrN2O4 and a molecular weight of 345.19 g/mol. Its IUPAC name is 2-[[(2-bromophenyl)methyl-methylcarbamoyl]amino]-3-methoxypropanoic acid.
| Compound Name | 2-[[(2-bromophenyl)methyl-methylcarbamoyl]amino]-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 81084331 |
| Molecular Formula | C13H17BrN2O4 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 2-[[(2-bromophenyl)methyl-methylcarbamoyl]amino]-3-methoxypropanoic acid |
| SMILES | COCC(NC(=O)N(C)Cc1ccccc1Br)C(=O)O |
| InChI | InChI=1S/C13H17BrN2O4/c1-16(7-9-5-3-4-6-10(9)14)13(19)15-11(8-20-2)12(17)18/h3-6,11H,7-8H2,1-2H3,(H,15,19)(H,17,18) |
| InChIKey | QCGIRBVIKFOJSW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |