C10H20N2O4S — CID 112662945
3-methoxy-2-[[methyl(1-methylsulfanylpropan-2-yl)carbamoyl]amino]propanoic acid (PubChem CID 112662945) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is 3-methoxy-2-[[methyl(1-methylsulfanylpropan-2-yl)carbamoyl]amino]propanoic acid.
| Compound Name | 3-methoxy-2-[[methyl(1-methylsulfanylpropan-2-yl)carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 112662945 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 3-methoxy-2-[[methyl(1-methylsulfanylpropan-2-yl)carbamoyl]amino]propanoic acid |
| SMILES | COCC(NC(=O)N(C)C(C)CSC)C(=O)O |
| InChI | InChI=1S/C10H20N2O4S/c1-7(6-17-4)12(2)10(15)11-8(5-16-3)9(13)14/h7-8H,5-6H2,1-4H3,(H,11,15)(H,13,14) |
| InChIKey | FVRRUVFVUOSZQO-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |