C14H32N2O4 — CID 57436594
1,1-bis(2-ethoxyethyl)-2,2-bis(2-methoxyethyl)hydrazine (PubChem CID 57436594) has the molecular formula C14H32N2O4 and a molecular weight of 292.42 g/mol. Its IUPAC name is 1,1-bis(2-ethoxyethyl)-2,2-bis(2-methoxyethyl)hydrazine.
| Compound Name | 1,1-bis(2-ethoxyethyl)-2,2-bis(2-methoxyethyl)hydrazine |
|---|---|
| PubChem CID | 57436594 |
| Molecular Formula | C14H32N2O4 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 1,1-bis(2-ethoxyethyl)-2,2-bis(2-methoxyethyl)hydrazine |
| SMILES | CCOCCN(CCOCC)N(CCOC)CCOC |
| InChI | InChI=1S/C14H32N2O4/c1-5-19-13-9-16(10-14-20-6-2)15(7-11-17-3)8-12-18-4/h5-14H2,1-4H3 |
| InChIKey | MZJHMBQHXCNZTK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|