C10H24N2O2 — CID 57429150
1,1-diethyl-2,2-bis(2-methoxyethyl)hydrazine (PubChem CID 57429150) has the molecular formula C10H24N2O2 and a molecular weight of 204.31 g/mol. Its IUPAC name is 1,1-diethyl-2,2-bis(2-methoxyethyl)hydrazine.
| Compound Name | 1,1-diethyl-2,2-bis(2-methoxyethyl)hydrazine |
|---|---|
| PubChem CID | 57429150 |
| Molecular Formula | C10H24N2O2 |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.18 |
| IUPAC Name | 1,1-diethyl-2,2-bis(2-methoxyethyl)hydrazine |
| SMILES | CCN(CC)N(CCOC)CCOC |
| InChI | InChI=1S/C10H24N2O2/c1-5-11(6-2)12(7-9-13-3)8-10-14-4/h5-10H2,1-4H3 |
| InChIKey | TYFXPXQFGXWLMB-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|