C7H15NO2 — CID 58998146
CID 58998146 (PubChem CID 58998146) has the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol.
| Compound Name | CID 58998146 |
|---|---|
| PubChem CID | 58998146 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | — |
| SMILES | [CH]N(CCOC)CCOC |
| InChI | InChI=1S/C7H15NO2/c1-8(4-6-9-2)5-7-10-3/h1H,4-7H2,2-3H3 |
| InChIKey | VKISAOYPGHFTAB-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|