C7H18N2O2 — CID 54251784
1,1-bis(2-methoxyethyl)-2-methylhydrazine (PubChem CID 54251784) has the molecular formula C7H18N2O2 and a molecular weight of 162.23 g/mol. Its IUPAC name is 1,1-bis(2-methoxyethyl)-2-methylhydrazine.
| Compound Name | 1,1-bis(2-methoxyethyl)-2-methylhydrazine |
|---|---|
| PubChem CID | 54251784 |
| Molecular Formula | C7H18N2O2 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 1,1-bis(2-methoxyethyl)-2-methylhydrazine |
| SMILES | CNN(CCOC)CCOC |
| InChI | InChI=1S/C7H18N2O2/c1-8-9(4-6-10-2)5-7-11-3/h8H,4-7H2,1-3H3 |
| InChIKey | BMJZXIOMCRSTBE-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|