C6H10N2O2 — CID 135140646
(2Z,4Z)-4-amino-3-hydroxyhexa-2,4-dienamide (PubChem CID 135140646) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is (2Z,4Z)-4-amino-3-hydroxyhexa-2,4-dienamide.
| Compound Name | (2Z,4Z)-4-amino-3-hydroxyhexa-2,4-dienamide |
|---|---|
| PubChem CID | 135140646 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | (2Z,4Z)-4-amino-3-hydroxyhexa-2,4-dienamide |
| SMILES | C/C=C(N)/C(O)=C/C(N)=O |
| InChI | InChI=1S/C6H10N2O2/c1-2-4(7)5(9)3-6(8)10/h2-3,9H,7H2,1H3,(H2,8,10)/b4-2-,5-3- |
| InChIKey | XLBORFUATBKEIG-JVLMNHKTSA-N |
| XLogP | -0.22 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|