About but-2-en-2-ol;urea
but-2-en-2-ol;urea (PubChem CID 173334764) has the molecular formula C5H12N2O2
and a molecular weight of 132.16 g/mol. Its IUPAC name is but-2-en-2-ol;urea.
Molecular Properties
| Compound Name | but-2-en-2-ol;urea |
| PubChem CID | 173334764 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | but-2-en-2-ol;urea |
| SMILES | CC=C(C)O.NC(N)=O |
| InChI | InChI=1S/C4H8O.CH4N2O/c1-3-4(2)5;2-1(3)4/h3,5H,1-2H3;(H4,2,3,4) |
| InChIKey | NNFRTNRRGCLFPO-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze but-2-en-2-ol;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-en-2-ol;urea?
The IUPAC name of but-2-en-2-ol;urea (CID 173334764) is but-2-en-2-ol;urea.
What is the SMILES notation for but-2-en-2-ol;urea?
The canonical SMILES for but-2-en-2-ol;urea is CC=C(C)O.NC(N)=O.
What is the InChIKey of but-2-en-2-ol;urea?
The InChIKey is NNFRTNRRGCLFPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.CH4N2O/c1-3-4(2)5;2-1(3)4/h3,5H,1-2H3;(H4,2,3,4).
What are the key properties of but-2-en-2-ol;urea?
but-2-en-2-ol;urea has a molecular weight of 132.16 g/mol, XLogP of 0.49, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-en-2-ol;urea is sourced from PubChem (CID 173334764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).