About hydrogen peroxide;urea;zinc
hydrogen peroxide;urea;zinc (PubChem CID 161338139) has the molecular formula CH6N2O3Zn
and a molecular weight of 159.46 g/mol. Its IUPAC name is hydrogen peroxide;urea;zinc.
Molecular Properties
| Compound Name | hydrogen peroxide;urea;zinc |
| PubChem CID | 161338139 |
| Molecular Formula | CH6N2O3Zn |
| Molecular Weight | 159.46 g/mol |
| Exact Mass | 157.97 |
| IUPAC Name | hydrogen peroxide;urea;zinc |
| SMILES | NC(N)=O.OO.[Zn] |
| InChI | InChI=1S/CH4N2O.H2O2.Zn/c2-1(3)4;1-2;/h(H4,2,3,4);1-2H; |
| InChIKey | VMHSKNZXDHVQGX-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.46 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze hydrogen peroxide;urea;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen peroxide;urea;zinc?
The IUPAC name of hydrogen peroxide;urea;zinc (CID 161338139) is hydrogen peroxide;urea;zinc.
What is the SMILES notation for hydrogen peroxide;urea;zinc?
The canonical SMILES for hydrogen peroxide;urea;zinc is NC(N)=O.OO.[Zn].
What is the InChIKey of hydrogen peroxide;urea;zinc?
The InChIKey is VMHSKNZXDHVQGX-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O.H2O2.Zn/c2-1(3)4;1-2;/h(H4,2,3,4);1-2H;.
What are the key properties of hydrogen peroxide;urea;zinc?
hydrogen peroxide;urea;zinc has a molecular weight of 159.46 g/mol, XLogP of -0.96, 0 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen peroxide;urea;zinc is sourced from PubChem (CID 161338139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).