hydrogen peroxide;urea;zinc

CH6N2O3Zn — CID 161338139

IUPAChydrogen peroxide;urea;zinc
SMILESNC(N)=O.OO.[Zn]
InChIInChI=1S/CH4N2O.H2O2.Zn/c2-1(3)4;1-2;/h(H4,2,3,4);1-2H;
InChIKeyVMHSKNZXDHVQGX-UHFFFAOYSA-N
MW159.46 g/mol
LogP-0.96
Rot. Bonds

About hydrogen peroxide;urea;zinc

hydrogen peroxide;urea;zinc (PubChem CID 161338139) has the molecular formula CH6N2O3Zn and a molecular weight of 159.46 g/mol. Its IUPAC name is hydrogen peroxide;urea;zinc.

Molecular Properties

Compound Namehydrogen peroxide;urea;zinc
PubChem CID161338139
Molecular FormulaCH6N2O3Zn
Molecular Weight159.46 g/mol
Exact Mass157.97
IUPAC Namehydrogen peroxide;urea;zinc
SMILESNC(N)=O.OO.[Zn]
InChIInChI=1S/CH4N2O.H2O2.Zn/c2-1(3)4;1-2;/h(H4,2,3,4);1-2H;
InChIKeyVMHSKNZXDHVQGX-UHFFFAOYSA-N
XLogP-0.96
TPSA109.57 Ų
H-Bond Donors4
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms7
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500159.46
LogP ≤ 5-0.96
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze hydrogen peroxide;urea;zinc with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydrogen peroxide;urea;zinc?
The IUPAC name of hydrogen peroxide;urea;zinc (CID 161338139) is hydrogen peroxide;urea;zinc.
What is the SMILES notation for hydrogen peroxide;urea;zinc?
The canonical SMILES for hydrogen peroxide;urea;zinc is NC(N)=O.OO.[Zn].
What is the InChIKey of hydrogen peroxide;urea;zinc?
The InChIKey is VMHSKNZXDHVQGX-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O.H2O2.Zn/c2-1(3)4;1-2;/h(H4,2,3,4);1-2H;.
What are the key properties of hydrogen peroxide;urea;zinc?
hydrogen peroxide;urea;zinc has a molecular weight of 159.46 g/mol, XLogP of -0.96, 0 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen peroxide;urea;zinc is sourced from PubChem (CID 161338139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).