About bis((Z)-3-amino-3-hydroxyprop-2-enamide);oxovanadium
bis((Z)-3-amino-3-hydroxyprop-2-enamide);oxovanadium (PubChem CID 59391475) has the molecular formula C6H12N4O5V
and a molecular weight of 271.13 g/mol. Its IUPAC name is bis((Z)-3-amino-3-hydroxyprop-2-enamide);oxovanadium.
Molecular Properties
| Compound Name | bis((Z)-3-amino-3-hydroxyprop-2-enamide);oxovanadium |
| PubChem CID | 59391475 |
| Molecular Formula | C6H12N4O5V |
| Molecular Weight | 271.13 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | bis((Z)-3-amino-3-hydroxyprop-2-enamide);oxovanadium |
| SMILES | NC(=O)/C=C(/N)O.NC(=O)/C=C(/N)O.O=[V] |
| InChI | InChI=1S/2C3H6N2O2.O.V/c2*4-2(6)1-3(5)7;;/h2*1,6H,4H2,(H2,5,7);;/b2*2-1-;; |
| InChIKey | OLJPDFZOKPCDCY-SUXDNRKISA-N |
| XLogP | -2.46 |
| TPSA | 195.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 271.13 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis((Z)-3-amino-3-hydroxyprop-2-enamide);oxovanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((Z)-3-amino-3-hydroxyprop-2-enamide);oxovanadium?
The IUPAC name of bis((Z)-3-amino-3-hydroxyprop-2-enamide);oxovanadium (CID 59391475) is bis((Z)-3-amino-3-hydroxyprop-2-enamide);oxovanadium.
What is the SMILES notation for bis((Z)-3-amino-3-hydroxyprop-2-enamide);oxovanadium?
The canonical SMILES for bis((Z)-3-amino-3-hydroxyprop-2-enamide);oxovanadium is NC(=O)/C=C(/N)O.NC(=O)/C=C(/N)O.O=[V].
What is the InChIKey of bis((Z)-3-amino-3-hydroxyprop-2-enamide);oxovanadium?
The InChIKey is OLJPDFZOKPCDCY-SUXDNRKISA-N. The full InChI is InChI=1S/2C3H6N2O2.O.V/c2*4-2(6)1-3(5)7;;/h2*1,6H,4H2,(H2,5,7);;/b2*2-1-;;.
What are the key properties of bis((Z)-3-amino-3-hydroxyprop-2-enamide);oxovanadium?
bis((Z)-3-amino-3-hydroxyprop-2-enamide);oxovanadium has a molecular weight of 271.13 g/mol, XLogP of -2.46, 2 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis((Z)-3-amino-3-hydroxyprop-2-enamide);oxovanadium is sourced from PubChem (CID 59391475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).