C5H12N2 — CID 123432915
1,2-dimethyl-1-prop-1-enylhydrazine (PubChem CID 123432915) has the molecular formula C5H12N2 and a molecular weight of 100.16 g/mol. Its IUPAC name is 1,2-dimethyl-1-prop-1-enylhydrazine.
| Compound Name | 1,2-dimethyl-1-prop-1-enylhydrazine |
|---|---|
| PubChem CID | 123432915 |
| Molecular Formula | C5H12N2 |
| Molecular Weight | 100.16 g/mol |
| Exact Mass | 100.10 |
| IUPAC Name | 1,2-dimethyl-1-prop-1-enylhydrazine |
| SMILES | CC=CN(C)NC |
| InChI | InChI=1S/C5H12N2/c1-4-5-7(3)6-2/h4-6H,1-3H3 |
| InChIKey | GVUUWNITIYARPM-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.16 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|