C7H16N2 — CID 126633418
1-N,1-N'-dimethyl-1-N'-[(Z)-prop-1-enyl]ethane-1,1-diamine (PubChem CID 126633418) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is 1-N,1-N'-dimethyl-1-N'-[(Z)-prop-1-enyl]ethane-1,1-diamine.
| Compound Name | 1-N,1-N'-dimethyl-1-N'-[(Z)-prop-1-enyl]ethane-1,1-diamine |
|---|---|
| PubChem CID | 126633418 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | 1-N,1-N'-dimethyl-1-N'-[(Z)-prop-1-enyl]ethane-1,1-diamine |
| SMILES | C/C=C\N(C)C(C)NC |
| InChI | InChI=1S/C7H16N2/c1-5-6-9(4)7(2)8-3/h5-8H,1-4H3/b6-5- |
| InChIKey | PMKHIWIWMPFHLI-WAYWQWQTSA-N |
| XLogP | 1.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|