C6H17N3 — CID 118529087
N,N',N',N",N"-pentamethylmethanetriamine (PubChem CID 118529087) has the molecular formula C6H17N3 and a molecular weight of 131.22 g/mol. Its IUPAC name is N,N',N',N",N"-pentamethylmethanetriamine.
| Compound Name | N,N',N',N",N"-pentamethylmethanetriamine |
|---|---|
| PubChem CID | 118529087 |
| Molecular Formula | C6H17N3 |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.14 |
| IUPAC Name | N,N',N',N",N"-pentamethylmethanetriamine |
| SMILES | CNC(N(C)C)N(C)C |
| InChI | InChI=1S/C6H17N3/c1-7-6(8(2)3)9(4)5/h6-7H,1-5H3 |
| InChIKey | LRQPBLKJDGXUEW-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|