C9H25N3Si — CID 173059239
N',N',N",N"-tetramethyl-N-(2-methyl-2-silylpropyl)methanetriamine (PubChem CID 173059239) has the molecular formula C9H25N3Si and a molecular weight of 203.41 g/mol. Its IUPAC name is N',N',N",N"-tetramethyl-N-(2-methyl-2-silylpropyl)methanetriamine.
| Compound Name | N',N',N",N"-tetramethyl-N-(2-methyl-2-silylpropyl)methanetriamine |
|---|---|
| PubChem CID | 173059239 |
| Molecular Formula | C9H25N3Si |
| Molecular Weight | 203.41 g/mol |
| Exact Mass | 203.18 |
| IUPAC Name | N',N',N",N"-tetramethyl-N-(2-methyl-2-silylpropyl)methanetriamine |
| SMILES | CN(C)C(NCC(C)(C)[SiH3])N(C)C |
| InChI | InChI=1S/C9H25N3Si/c1-9(2,13)7-10-8(11(3)4)12(5)6/h8,10H,7H2,1-6,13H3 |
| InChIKey | GVWISWHQGFYJAV-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.41 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|