C12H29NSi — CID 173042383
N,N,2-trimethyl-2-silylnonan-3-amine (PubChem CID 173042383) has the molecular formula C12H29NSi and a molecular weight of 215.46 g/mol. Its IUPAC name is N,N,2-trimethyl-2-silylnonan-3-amine.
| Compound Name | N,N,2-trimethyl-2-silylnonan-3-amine |
|---|---|
| PubChem CID | 173042383 |
| Molecular Formula | C12H29NSi |
| Molecular Weight | 215.46 g/mol |
| Exact Mass | 215.21 |
| IUPAC Name | N,N,2-trimethyl-2-silylnonan-3-amine |
| SMILES | CCCCCCC(N(C)C)C(C)(C)[SiH3] |
| InChI | InChI=1S/C12H29NSi/c1-6-7-8-9-10-11(13(4)5)12(2,3)14/h11H,6-10H2,1-5,14H3 |
| InChIKey | ZXQUZJZXPDNNLZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|