C9H23N3 — CID 126728251
1-N',1-N',2-trimethyl-1-N-[1-(methylamino)ethyl]propane-1,1-diamine (PubChem CID 126728251) has the molecular formula C9H23N3 and a molecular weight of 173.30 g/mol. Its IUPAC name is 1-N',1-N',2-trimethyl-1-N-[1-(methylamino)ethyl]propane-1,1-diamine.
| Compound Name | 1-N',1-N',2-trimethyl-1-N-[1-(methylamino)ethyl]propane-1,1-diamine |
|---|---|
| PubChem CID | 126728251 |
| Molecular Formula | C9H23N3 |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.19 |
| IUPAC Name | 1-N',1-N',2-trimethyl-1-N-[1-(methylamino)ethyl]propane-1,1-diamine |
| SMILES | CNC(C)NC(C(C)C)N(C)C |
| InChI | InChI=1S/C9H23N3/c1-7(2)9(12(5)6)11-8(3)10-4/h7-11H,1-6H3 |
| InChIKey | URWGUJJOQUDFQD-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|