About 1-N-methyl-1-N'-phenylethane-1,1-diamine
1-N-methyl-1-N'-phenylethane-1,1-diamine (PubChem CID 88759522) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 1-N-methyl-1-N'-phenylethane-1,1-diamine.
Molecular Properties
| Compound Name | 1-N-methyl-1-N'-phenylethane-1,1-diamine |
| PubChem CID | 88759522 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 1-N-methyl-1-N'-phenylethane-1,1-diamine |
| SMILES | CNC(C)Nc1ccccc1 |
| InChI | InChI=1S/C9H14N2/c1-8(10-2)11-9-6-4-3-5-7-9/h3-8,10-11H,1-2H3 |
| InChIKey | LLBAPFSDDWNBAG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-N-methyl-1-N'-phenylethane-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-methyl-1-N'-phenylethane-1,1-diamine?
The IUPAC name of 1-N-methyl-1-N'-phenylethane-1,1-diamine (CID 88759522) is 1-N-methyl-1-N'-phenylethane-1,1-diamine.
What is the SMILES notation for 1-N-methyl-1-N'-phenylethane-1,1-diamine?
The canonical SMILES for 1-N-methyl-1-N'-phenylethane-1,1-diamine is CNC(C)Nc1ccccc1.
What is the InChIKey of 1-N-methyl-1-N'-phenylethane-1,1-diamine?
The InChIKey is LLBAPFSDDWNBAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-8(10-2)11-9-6-4-3-5-7-9/h3-8,10-11H,1-2H3.
What are the key properties of 1-N-methyl-1-N'-phenylethane-1,1-diamine?
1-N-methyl-1-N'-phenylethane-1,1-diamine has a molecular weight of 150.22 g/mol, XLogP of 1.66, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-methyl-1-N'-phenylethane-1,1-diamine is sourced from PubChem (CID 88759522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).