C15H40N4O — CID 143703207
2-[2-aminoethyl(propyl)amino]ethanol;ethane;1-N-methyl-1-N'-propan-2-ylethane-1,1-diamine (PubChem CID 143703207) has the molecular formula C15H40N4O and a molecular weight of 292.51 g/mol. Its IUPAC name is 2-[2-aminoethyl(propyl)amino]ethanol;ethane;1-N-methyl-1-N'-propan-2-ylethane-1,1-diamine.
| Compound Name | 2-[2-aminoethyl(propyl)amino]ethanol;ethane;1-N-methyl-1-N'-propan-2-ylethane-1,1-diamine |
|---|---|
| PubChem CID | 143703207 |
| Molecular Formula | C15H40N4O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.32 |
| IUPAC Name | 2-[2-aminoethyl(propyl)amino]ethanol;ethane;1-N-methyl-1-N'-propan-2-ylethane-1,1-diamine |
| SMILES | CC.CCCN(CCN)CCO.CNC(C)NC(C)C |
| InChI | InChI=1S/C7H18N2O.C6H16N2.C2H6/c1-2-4-9(5-3-8)6-7-10;1-5(2)8-6(3)7-4;1-2/h10H,2-8H2,1H3;5-8H,1-4H3;1-2H3 |
| InChIKey | JYRMBXMGXSJQIF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 73.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|