C10H26N4 — CID 140976966
1-N'-(ethylamino)-1-N,2-dimethyl-1-N'-(propan-2-ylamino)propane-1,1-diamine (PubChem CID 140976966) has the molecular formula C10H26N4 and a molecular weight of 202.35 g/mol. Its IUPAC name is 1-N'-(ethylamino)-1-N,2-dimethyl-1-N'-(propan-2-ylamino)propane-1,1-diamine.
| Compound Name | 1-N'-(ethylamino)-1-N,2-dimethyl-1-N'-(propan-2-ylamino)propane-1,1-diamine |
|---|---|
| PubChem CID | 140976966 |
| Molecular Formula | C10H26N4 |
| Molecular Weight | 202.35 g/mol |
| Exact Mass | 202.22 |
| IUPAC Name | 1-N'-(ethylamino)-1-N,2-dimethyl-1-N'-(propan-2-ylamino)propane-1,1-diamine |
| SMILES | CCNN(NC(C)C)C(NC)C(C)C |
| InChI | InChI=1S/C10H26N4/c1-7-12-14(13-9(4)5)10(11-6)8(2)3/h8-13H,7H2,1-6H3 |
| InChIKey | NEXBYAJPISQDAH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|