C13H33N5 — CID 141048663
1-N'-ethyl-1-N,2-dimethyl-2-N-(propan-2-ylamino)-2-N-(propylamino)propane-1,1,2-triamine (PubChem CID 141048663) has the molecular formula C13H33N5 and a molecular weight of 259.44 g/mol. Its IUPAC name is 1-N'-ethyl-1-N,2-dimethyl-2-N-(propan-2-ylamino)-2-N-(propylamino)propane-1,1,2-triamine.
| Compound Name | 1-N'-ethyl-1-N,2-dimethyl-2-N-(propan-2-ylamino)-2-N-(propylamino)propane-1,1,2-triamine |
|---|---|
| PubChem CID | 141048663 |
| Molecular Formula | C13H33N5 |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.27 |
| IUPAC Name | 1-N'-ethyl-1-N,2-dimethyl-2-N-(propan-2-ylamino)-2-N-(propylamino)propane-1,1,2-triamine |
| SMILES | CCCNN(NC(C)C)C(C)(C)C(NC)NCC |
| InChI | InChI=1S/C13H33N5/c1-8-10-16-18(17-11(3)4)13(5,6)12(14-7)15-9-2/h11-12,14-17H,8-10H2,1-7H3 |
| InChIKey | UMMGPKOYCBSNOT-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 51.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|