C9H24N2 — CID 143131387
ethane;1-N-ethyl-1-N'-propylethane-1,1-diamine (PubChem CID 143131387) has the molecular formula C9H24N2 and a molecular weight of 160.30 g/mol. Its IUPAC name is ethane;1-N-ethyl-1-N'-propylethane-1,1-diamine.
| Compound Name | ethane;1-N-ethyl-1-N'-propylethane-1,1-diamine |
|---|---|
| PubChem CID | 143131387 |
| Molecular Formula | C9H24N2 |
| Molecular Weight | 160.30 g/mol |
| Exact Mass | 160.19 |
| IUPAC Name | ethane;1-N-ethyl-1-N'-propylethane-1,1-diamine |
| SMILES | CC.CCCNC(C)NCC |
| InChI | InChI=1S/C7H18N2.C2H6/c1-4-6-9-7(3)8-5-2;1-2/h7-9H,4-6H2,1-3H3;1-2H3 |
| InChIKey | FKWGASVVXAFGBA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|