C11H26N2 — CID 21407863
1,1-dibutyl-2-propan-2-ylhydrazine (PubChem CID 21407863) has the molecular formula C11H26N2 and a molecular weight of 186.34 g/mol. Its IUPAC name is 1,1-dibutyl-2-propan-2-ylhydrazine.
| Compound Name | 1,1-dibutyl-2-propan-2-ylhydrazine |
|---|---|
| PubChem CID | 21407863 |
| Molecular Formula | C11H26N2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.21 |
| IUPAC Name | 1,1-dibutyl-2-propan-2-ylhydrazine |
| SMILES | CCCCN(CCCC)NC(C)C |
| InChI | InChI=1S/C11H26N2/c1-5-7-9-13(10-8-6-2)12-11(3)4/h11-12H,5-10H2,1-4H3 |
| InChIKey | YJBUXGIVLORUAH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|