C6H18N4 — CID 175151430
1-N-methyl-1-N',1-N'-bis(methylamino)propane-1,1-diamine (PubChem CID 175151430) has the molecular formula C6H18N4 and a molecular weight of 146.24 g/mol. Its IUPAC name is 1-N-methyl-1-N',1-N'-bis(methylamino)propane-1,1-diamine.
| Compound Name | 1-N-methyl-1-N',1-N'-bis(methylamino)propane-1,1-diamine |
|---|---|
| PubChem CID | 175151430 |
| Molecular Formula | C6H18N4 |
| Molecular Weight | 146.24 g/mol |
| Exact Mass | 146.15 |
| IUPAC Name | 1-N-methyl-1-N',1-N'-bis(methylamino)propane-1,1-diamine |
| SMILES | CCC(NC)N(NC)NC |
| InChI | InChI=1S/C6H18N4/c1-5-6(7-2)10(8-3)9-4/h6-9H,5H2,1-4H3 |
| InChIKey | QHIUBXIDOKLENJ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.24 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|