C11H28Cl2N4O — CID 23325980
1,3-bis[1-(dimethylamino)propyl]urea;dihydrochloride (PubChem CID 23325980) has the molecular formula C11H28Cl2N4O and a molecular weight of 303.28 g/mol. Its IUPAC name is 1,3-bis[1-(dimethylamino)propyl]urea;dihydrochloride.
| Compound Name | 1,3-bis[1-(dimethylamino)propyl]urea;dihydrochloride |
|---|---|
| PubChem CID | 23325980 |
| Molecular Formula | C11H28Cl2N4O |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 1,3-bis[1-(dimethylamino)propyl]urea;dihydrochloride |
| SMILES | CCC(NC(=O)NC(CC)N(C)C)N(C)C.Cl.Cl |
| InChI | InChI=1S/C11H26N4O.2ClH/c1-7-9(14(3)4)12-11(16)13-10(8-2)15(5)6;;/h9-10H,7-8H2,1-6H3,(H2,12,13,16);2*1H |
| InChIKey | SFTCFZNMZLOFKY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|